CAS
59626-33-4 Purity
---
59626-33-4 Purity
---
Inquiry Basket
3-Bromo-6-methoxy-8-nitro quinoline
CAS
95836-48-9
Catalog Number
ACM95836489
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 3-Bromo-6-methoxy-8-nitro quinoline?
The molecular formula of 3-Bromo-6-methoxy-8-nitro quinoline is C10H7BrN2O3.
What is the molecular weight of 3-Bromo-6-methoxy-8-nitro quinoline?
The molecular weight of 3-Bromo-6-methoxy-8-nitro quinoline is 283.08 g/mol.
What is the IUPAC name of 3-Bromo-6-methoxy-8-nitro quinoline?
The IUPAC name of 3-Bromo-6-methoxy-8-nitro quinoline is 3-bromo-6-methoxy-8-nitroquinoline.
What is the InChI of 3-Bromo-6-methoxy-8-nitro quinoline?
The InChI of 3-Bromo-6-methoxy-8-nitro quinoline is InChI=1S/C10H7BrN2O3/c1-16-8-3-6-2-7(11)5-12-10(6)9(4-8)13(14)15/h2-5H,1H3.
What is the InChIKey of 3-Bromo-6-methoxy-8-nitro quinoline?
The InChIKey of 3-Bromo-6-methoxy-8-nitro quinoline is OIXRPIQCIQDGPL-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Bromo-6-methoxy-8-nitro quinoline?
The canonical SMILES of 3-Bromo-6-methoxy-8-nitro quinoline is COC1=CC(=C2C(=C1)C=C(C=N2)Br)[N+](=O)[O-].
What is the CAS number of 3-Bromo-6-methoxy-8-nitro quinoline?
The CAS number of 3-Bromo-6-methoxy-8-nitro quinoline is 95836-48-9.
What is the XLogP3 value of 3-Bromo-6-methoxy-8-nitro quinoline?
The XLogP3 value of 3-Bromo-6-methoxy-8-nitro quinoline is 2.6.
How many hydrogen bond donor counts does 3-Bromo-6-methoxy-8-nitro quinoline have?
3-Bromo-6-methoxy-8-nitro quinoline has 0 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 3-Bromo-6-methoxy-8-nitro quinoline have?
3-Bromo-6-methoxy-8-nitro quinoline has 4 hydrogen bond acceptor counts.
Recommended Products
![2-[4-(Bromomethyl)phenyl]propanoic acid](https://resource.alfa-chemistry.com/structure/111128-12-2.gif)
