CAS
40899-37-4 Purity
---
40899-37-4 Purity
---
Inquiry Basket
2-Amino-1-(3-bromophenyl)ethanol
CAS
41147-81-3
Catalog Number
ACM41147813
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 2-Amino-1-(3-bromophenyl)ethanol?
The molecular formula of 2-Amino-1-(3-bromophenyl)ethanol is C8H10BrNO.
What is the molecular weight of 2-Amino-1-(3-bromophenyl)ethanol?
The molecular weight of 2-Amino-1-(3-bromophenyl)ethanol is 216.07 g/mol.
What is the IUPAC name of 2-Amino-1-(3-bromophenyl)ethanol?
The IUPAC name of 2-Amino-1-(3-bromophenyl)ethanol is 2-amino-1-(3-bromophenyl)ethanol.
What is the InChI of 2-Amino-1-(3-bromophenyl)ethanol?
The InChI of 2-Amino-1-(3-bromophenyl)ethanol is InChI=1S/C8H10BrNO/c9-7-3-1-2-6(4-7)8(11)5-10/h1-4,8,11H,5,10H2.
What is the InChIKey of 2-Amino-1-(3-bromophenyl)ethanol?
The InChIKey of 2-Amino-1-(3-bromophenyl)ethanol is MKDZOLCWDXTLIF-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Amino-1-(3-bromophenyl)ethanol?
The canonical SMILES of 2-Amino-1-(3-bromophenyl)ethanol is C1=CC(=CC(=C1)Br)C(CN)O.
What is the CAS number of 2-Amino-1-(3-bromophenyl)ethanol?
The CAS number of 2-Amino-1-(3-bromophenyl)ethanol is 41147-81-3.
What is the XLogP3-AA value of 2-Amino-1-(3-bromophenyl)ethanol?
The XLogP3-AA value of 2-Amino-1-(3-bromophenyl)ethanol is 0.8.
How many hydrogen bond donor counts does 2-Amino-1-(3-bromophenyl)ethanol have?
2-Amino-1-(3-bromophenyl)ethanol has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 2-Amino-1-(3-bromophenyl)ethanol have?
2-Amino-1-(3-bromophenyl)ethanol has 2 hydrogen bond acceptor counts.
Recommended Products
