2-Amino-5-bromo-4,6-dimethylpyrimidine

• CAS: 4214-57-7
• Catalog Number: ACM4214577
• Category: Bromine Series

Custom Q&A

What is the molecular formula of 2-Amino-5-bromo-4,6-dimethylpyrimidine?

The molecular formula is C6H8BrN3.

What is the molecular weight of 2-Amino-5-bromo-4,6-dimethylpyrimidine?

The molecular weight is 202.05 g/mol.

What is the IUPAC name of 2-Amino-5-bromo-4,6-dimethylpyrimidine?

The IUPAC name is 5-bromo-4,6-dimethylpyrimidin-2-amine.

What is the InChI of 2-Amino-5-bromo-4,6-dimethylpyrimidine?

The InChI is InChI=1S/C6H8BrN3/c1-3-5(7)4(2)10-6(8)9-3/h1-2H3,(H2,8,9,10).

What is the InChIKey of 2-Amino-5-bromo-4,6-dimethylpyrimidine?

The InChIKey is ACJZZTRAZBNBGJ-UHFFFAOYSA-N.

What is the canonical SMILES of 2-Amino-5-bromo-4,6-dimethylpyrimidine?

The canonical SMILES is CC1=C(C(=NC(=N1)N)C)Br.

What is the CAS number of 2-Amino-5-bromo-4,6-dimethylpyrimidine?

The CAS number is 4214-57-7.

How many hydrogen bond donor counts are there in 2-Amino-5-bromo-4,6-dimethylpyrimidine?

There is 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts are there in 2-Amino-5-bromo-4,6-dimethylpyrimidine?

There are 3 hydrogen bond acceptor counts.