2-(Allyloxy)benzoic acid

• Catalog Number: ACMA00002074
• Category: Ethers
• Molecular Weight: 178.18
• Molecular Formula: C₁₀H₉NO₃
• Hazard Statements: H302
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 2-(Allyloxy)benzoic acid?

The molecular formula is C10H10O3.

What is the molecular weight of 2-(Allyloxy)benzoic acid?

The molecular weight is 178.18 g/mol.

What is the IUPAC name of 2-(Allyloxy)benzoic acid?

The IUPAC name is 2-prop-2-enoxybenzoic acid.

What is the InChI of 2-(Allyloxy)benzoic acid?

The InChI is InChI=1S/C10H10O3/c1-2-7-13-9-6-4-3-5-8(9)10(11)12/h2-6H,1,7H2,(H,11,12).

What is the InChIKey of 2-(Allyloxy)benzoic acid?

The InChIKey is XPWMIGFSEWFXEZ-UHFFFAOYSA-N.

How many hydrogen bond donor counts are there in 2-(Allyloxy)benzoic acid?

There is 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts are there in 2-(Allyloxy)benzoic acid?

There are 3 hydrogen bond acceptor counts.

What is the topological polar surface area of 2-(Allyloxy)benzoic acid?

The topological polar surface area is 46.5 Ų.

How many rotatable bond counts are there in 2-(Allyloxy)benzoic acid?

There are 4 rotatable bond counts.

Is 2-(Allyloxy)benzoic acid a canonicalized compound?

Yes, the compound is canonicalized.