3',4'-(Methylenedioxy)propiophenone

• Catalog Number: ACMA00002072
• Category: Ethers
• Molecular Weight: 178.18
• Molecular Formula: C₁₀H₁₀O₂
• Hazard Statements: H302
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 3,4-Methylenedioxypropiophenone?

The molecular formula of 3,4-Methylenedioxypropiophenone is C10H10O3.

What is the molecular weight of 3,4-Methylenedioxypropiophenone?

The molecular weight of 3,4-Methylenedioxypropiophenone is 178.18 g/mol.

What are some synonyms of 3,4-Methylenedioxypropiophenone?

Some synonyms of 3,4-Methylenedioxypropiophenone are 28281-49-4, 1-(benzo[d][1,3]dioxol-5-yl)propan-1-one, 1-(1,3-Benzodioxol-5-yl)-1-propanone, and more.

What is the IUPAC name of 3,4-Methylenedioxypropiophenone?

The IUPAC name of 3,4-Methylenedioxypropiophenone is 1-(1,3-benzodioxol-5-yl)propan-1-one.

What is the InChI of 3,4-Methylenedioxypropiophenone?

The InChI of 3,4-Methylenedioxypropiophenone is InChI=1S/C10H10O3/c1-2-8(11)7-3-4-9-10(5-7)13-6-12-9/h3-5H,2,6H2,1H3.

What is the InChIKey of 3,4-Methylenedioxypropiophenone?

The InChIKey of 3,4-Methylenedioxypropiophenone is RVBJGSPBFIUTTR-UHFFFAOYSA-N.

What are the computed properties of 3,4-Methylenedioxypropiophenone?

The computed properties of 3,4-Methylenedioxypropiophenone include molecular weight, XLogP3, hydrogen bond donor count, hydrogen bond acceptor count, rotatable bond count, exact mass, monoisotopic mass, topological polar surface area, heavy atom count, formal charge, complexity, isotope atom count, defined atom stereocenter count, and undefined atom stereocenter count.

What is the XLogP3 value of 3,4-Methylenedioxypropiophenone?

The XLogP3 value of 3,4-Methylenedioxypropiophenone is 1.7.

How many hydrogen bond acceptors are present in 3,4-Methylenedioxypropiophenone?

3,4-Methylenedioxypropiophenone has 3 hydrogen bond acceptors.

How many rotatable bonds are there in 3,4-Methylenedioxypropiophenone?

3,4-Methylenedioxypropiophenone has 2 rotatable bonds.