2,5-dibromo-3-phenylpyrazine

• CAS: 64163-10-6
• Catalog Number: ACM64163106
• Category: Pyrazines
• Molecular Weight: 314.0
• Molecular Formula: C10H6Br2N2
• Appearance: White powder

Custom Q&A

What is the molecular formula of 2,5-dibromo-3-phenylpyrazine?

The molecular formula of 2,5-dibromo-3-phenylpyrazine is C10H6Br2N2.

What is the molecular weight of 2,5-dibromo-3-phenylpyrazine?

The molecular weight of 2,5-dibromo-3-phenylpyrazine is 313.98 g/mol.

When was 2,5-dibromo-3-phenylpyrazine created and last modified in PubChem?

2,5-dibromo-3-phenylpyrazine was created on 2007-02-08 and last modified on 2023-12-30 in PubChem.

What is the IUPAC name of 2,5-dibromo-3-phenylpyrazine?

The IUPAC name of 2,5-dibromo-3-phenylpyrazine is 2,5-dibromo-3-phenylpyrazine.

What is the InChI of 2,5-dibromo-3-phenylpyrazine?

The InChI of 2,5-dibromo-3-phenylpyrazine is InChI=1S/C10H6Br2N2/c11-8-6-13-10(12)9(14-8)7-4-2-1-3-5-7/h1-6H.

How many hydrogen bond donor counts does 2,5-dibromo-3-phenylpyrazine have?

2,5-dibromo-3-phenylpyrazine has 0 hydrogen bond donor counts.

What is the XLogP3-AA value of 2,5-dibromo-3-phenylpyrazine?

The XLogP3-AA value of 2,5-dibromo-3-phenylpyrazine is 3.5.

What is the topological polar surface area of 2,5-dibromo-3-phenylpyrazine?

The topological polar surface area of 2,5-dibromo-3-phenylpyrazine is 25.8 Ų.

How many defined atom stereocenter counts does 2,5-dibromo-3-phenylpyrazine have?

2,5-dibromo-3-phenylpyrazine has 0 defined atom stereocenter counts.

Is the compound 2,5-dibromo-3-phenylpyrazine canonicalized in PubChem?

Yes, the compound 2,5-dibromo-3-phenylpyrazine is canonicalized in PubChem.