2,5-dibromo-3-chloropyrazine

• CAS: 21943-16-8
• Catalog Number: ACM21943168
• Category: Pyrazines
• Molecular Weight: 272.3
• Molecular Formula: C4HBr2ClN2
• Appearance: White powder

Custom Q&A

What is the molecular formula of 2,5-dibromo-3-chloropyrazine?

The molecular formula of 2,5-dibromo-3-chloropyrazine is C4HBr2ClN2.

What is the molecular weight of 2,5-dibromo-3-chloropyrazine?

The molecular weight of 2,5-dibromo-3-chloropyrazine is 272.32 g/mol.

What is the IUPAC name of 2,5-dibromo-3-chloropyrazine?

The IUPAC name of 2,5-dibromo-3-chloropyrazine is 2,5-dibromo-3-chloropyrazine.

What is the InChI of 2,5-dibromo-3-chloropyrazine?

The InChI of 2,5-dibromo-3-chloropyrazine is InChI=1S/C4HBr2ClN2/c5-2-1-8-3(6)4(7)9-2/h1H.

What is the InChIKey of 2,5-dibromo-3-chloropyrazine?

The InChIKey of 2,5-dibromo-3-chloropyrazine is NACQYBDFEPOOQF-UHFFFAOYSA-N.

What is the Canonical SMILES of 2,5-dibromo-3-chloropyrazine?

The Canonical SMILES of 2,5-dibromo-3-chloropyrazine is C1=C(N=C(C(=N1)Br)Cl)Br.

What is the CAS number of 2,5-dibromo-3-chloropyrazine?

The CAS number of 2,5-dibromo-3-chloropyrazine is 21943-16-8.

What is the molecular weight of 2,5-dibromo-3-chloropyrazine according to PubChem?

The molecular weight of 2,5-dibromo-3-chloropyrazine according to PubChem is 272.32 g/mol.

What is the XLogP3-AA value of 2,5-dibromo-3-chloropyrazine?

The XLogP3-AA value of 2,5-dibromo-3-chloropyrazine is 2.8.

How many hydrogen bond acceptor counts does 2,5-dibromo-3-chloropyrazine have?

2,5-dibromo-3-chloropyrazine has 2 hydrogen bond acceptor counts.