What is the molecular formula of 2,4-Difluoro-3-methoxycarbonylphenylboronic acid?
The molecular formula is C8H7BF2O4.
What is the PubChem CID of 2,4-Difluoro-3-methoxycarbonylphenylboronic acid?
The PubChem CID is 44247916.
When was 2,4-Difluoro-3-methoxycarbonylphenylboronic acid created and modified in PubChem?
It was created on November 9, 2009, and last modified on December 2, 2023.
What is the IUPAC name of 2,4-Difluoro-3-methoxycarbonylphenylboronic acid?
The IUPAC name is (2,4-difluoro-3-methoxycarbonylphenyl)boronic acid.
What is the InChl of 2,4-Difluoro-3-methoxycarbonylphenylboronic acid?
The InChI is InChI=1S/C8H7BF2O4/c1-15-8(12)6-5(10)3-2-4(7(6)11)9(13)14/h2-3,13-14H,1H3.
What is the InChlKey of 2,4-Difluoro-3-methoxycarbonylphenylboronic acid?
The InChIKey is DAXRETVCZVZSNS-UHFFFAOYSA-N.
What is the canonical SMILES of 2,4-Difluoro-3-methoxycarbonylphenylboronic acid?
The canonical SMILES is B(C1=C(C(=C(C=C1)F)C(=O)OC)F)(O)O.
What is the molecular weight of 2,4-Difluoro-3-methoxycarbonylphenylboronic acid?
The molecular weight is 215.95 g/mol.
How many hydrogen bond donor counts does 2,4-Difluoro-3-methoxycarbonylphenylboronic acid have?
It has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 2,4-Difluoro-3-methoxycarbonylphenylboronic acid have?
It has 6 hydrogen bond acceptor counts.