2,4-Difluoro-3-isopropoxyphenylboronic acid

• CAS: 1451390-95-6
• Catalog Number: ACM1451390956
• Category: Boronic Acids

Custom Q&A

What is the molecular formula of 2,4-Difluoro-3-isopropoxyphenylboronic acid?

The molecular formula of 2,4-Difluoro-3-isopropoxyphenylboronic acid is C9H11BF2O3.

What is the molecular weight of 2,4-Difluoro-3-isopropoxyphenylboronic acid?

The molecular weight of 2,4-Difluoro-3-isopropoxyphenylboronic acid is 215.99 g/mol.

What is the IUPAC name of 2,4-Difluoro-3-isopropoxyphenylboronic acid?

The IUPAC name of 2,4-Difluoro-3-isopropoxyphenylboronic acid is (2,4-difluoro-3-propan-2-yloxyphenyl)boronic acid.

What is the InChI of 2,4-Difluoro-3-isopropoxyphenylboronic acid?

The InChI of 2,4-Difluoro-3-isopropoxyphenylboronic acid is InChI=1S/C9H11BF2O3/c1-5(2)15-9-7(11)4-3-6(8(9)12)10(13)14/h3-5,13-14H,1-2H3.

What is the InChIKey of 2,4-Difluoro-3-isopropoxyphenylboronic acid?

The InChIKey of 2,4-Difluoro-3-isopropoxyphenylboronic acid is LTXLJWCQTYVYCS-UHFFFAOYSA-N.

What is the canonical SMILES of 2,4-Difluoro-3-isopropoxyphenylboronic acid?

The canonical SMILES of 2,4-Difluoro-3-isopropoxyphenylboronic acid is B(C1=C(C(=C(C=C1)F)OC(C)C)F)(O)O.

What is the CAS number of 2,4-Difluoro-3-isopropoxyphenylboronic acid?

The CAS number of 2,4-Difluoro-3-isopropoxyphenylboronic acid is 1451390-95-6.

How many hydrogen bond donor counts does 2,4-Difluoro-3-isopropoxyphenylboronic acid have?

2,4-Difluoro-3-isopropoxyphenylboronic acid has 2 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does 2,4-Difluoro-3-isopropoxyphenylboronic acid have?

2,4-Difluoro-3-isopropoxyphenylboronic acid has 5 hydrogen bond acceptor counts.

What is the topological polar surface area of 2,4-Difluoro-3-isopropoxyphenylboronic acid?

The topological polar surface area of 2,4-Difluoro-3-isopropoxyphenylboronic acid is 49.7Ų.