4-(Carboxymethyl)phenylboronic acid

• CAS: 9011-15-8
• Catalog Number: ACM9011158-1
• Category: Boronic Acids
• Molecular Weight: 179.97
• Molecular Formula: C8H9BO4

Custom Q&A

What is the molecular formula of 4-(Carboxymethyl)phenylboronic acid?

The molecular formula of 4-(Carboxymethyl)phenylboronic acid is C8H9BO4.

What is the molecular weight of 4-(Carboxymethyl)phenylboronic acid?

The molecular weight of 4-(Carboxymethyl)phenylboronic acid is 179.97 g/mol.

What is the IUPAC name of 4-(Carboxymethyl)phenylboronic acid?

The IUPAC name of 4-(Carboxymethyl)phenylboronic acid is 2-(4-boronophenyl)acetic acid.

What is the InChI of 4-(Carboxymethyl)phenylboronic acid?

The InChI of 4-(Carboxymethyl)phenylboronic acid is InChI=1S/C8H9BO4/c10-8(11)5-6-1-3-7(4-2-6)9(12)13/h1-4,12-13H,5H2,(H,10,11).

What is the InChIKey of 4-(Carboxymethyl)phenylboronic acid?

The InChIKey of 4-(Carboxymethyl)phenylboronic acid is NFGJQVPDPIGBJE-UHFFFAOYSA-N.

What is the canonical SMILES of 4-(Carboxymethyl)phenylboronic acid?

The canonical SMILES of 4-(Carboxymethyl)phenylboronic acid is B(C1=CC=C(C=C1)CC(=O)O)(O)O.

What is the CAS number of 4-(Carboxymethyl)phenylboronic acid?

The CAS number of 4-(Carboxymethyl)phenylboronic acid is 90111-58-3.

What is the EC number of 4-(Carboxymethyl)phenylboronic acid?

The EC number of 4-(Carboxymethyl)phenylboronic acid is 691-571-0.

Is 4-(Carboxymethyl)phenylboronic acid a canonicalized compound?

Yes, 4-(Carboxymethyl)phenylboronic acid is a canonicalized compound.