2,4-Dichloro-6-(trifluoromethyl)aniline

• CAS: 62593-17-3
• Catalog Number: ACM62593173
• Category: Amines
• Molecular Weight: 230.01
• Molecular Formula: C₇H₉NO₂S
• Hazard Statements: H301-H314-H335-H412
• RIDADR: NONH for all modes of transport
• Symbol: GHS05

Custom Q&A

What is the molecular formula of 2,4-Dichloro-6-(trifluoromethyl)aniline?

The molecular formula is C7H4Cl2F3N.

What is the molecular weight of 2,4-Dichloro-6-(trifluoromethyl)aniline?

The molecular weight is 230.01 g/mol.

What is the IUPAC name of 2,4-Dichloro-6-(trifluoromethyl)aniline?

The IUPAC name is 2,4-dichloro-6-(trifluoromethyl)aniline.

What is the InChI of 2,4-Dichloro-6-(trifluoromethyl)aniline?

The InChI is InChI=1S/C7H4Cl2F3N/c8-3-1-4(7(10,11)12)6(13)5(9)2-3/h1-2H,13H2.

What is the InChIKey of 2,4-Dichloro-6-(trifluoromethyl)aniline?

The InChIKey is OCJPQZFOBGQYEA-UHFFFAOYSA-N.

What is the canonical SMILES of 2,4-Dichloro-6-(trifluoromethyl)aniline?

The canonical SMILES is C1=C(C=C(C(=C1C(F)(F)F)N)Cl)Cl.

What is the CAS number of 2,4-Dichloro-6-(trifluoromethyl)aniline?

The CAS number is 62593-17-3.

What is the EC number of 2,4-Dichloro-6-(trifluoromethyl)aniline?

The EC number is 622-334-1.

What is the XLogP3-AA value of 2,4-Dichloro-6-(trifluoromethyl)aniline?

The XLogP3-AA value is 3.4.

Is 2,4-Dichloro-6-(trifluoromethyl)aniline a canonicalized compound?

Yes, it is a canonicalized compound.