(2,3-Dimethoxyphenyl)acetic acid

• Catalog Number: ACMA00002024
• Category: Ethers
• Molecular Weight: 196.20
• Molecular Formula: C₁₀H₁₂O₃
• Hazard Statements: H302
• RIDADR: UN 2811 6.1 / PGIII
• Symbol: GHS07

Custom Q&A

What is the molecular formula of (2,3-Dimethoxyphenyl)acetic acid?

The molecular formula is C10H12O4.

What is the molecular weight of (2,3-Dimethoxyphenyl)acetic acid?

The molecular weight is 196.20 g/mol.

What is the IUPAC name of (2,3-Dimethoxyphenyl)acetic acid?

The IUPAC name is 2-(2,3-dimethoxyphenyl)acetic acid.

What is the InChI of (2,3-Dimethoxyphenyl)acetic acid?

The InChI is InChI=1S/C10H12O4/c1-13-8-5-3-4-7(6-9(11)12)10(8)14-2/h3-5H,6H2,1-2H3,(H,11,12).

What is the InChIKey of (2,3-Dimethoxyphenyl)acetic acid?

The InChIKey is UZULEJNWMHZSGY-UHFFFAOYSA-N.

What is the canonical SMILES of (2,3-Dimethoxyphenyl)acetic acid?

The canonical SMILES is COC1=CC=CC(=C1OC)CC(=O)O.

What is the CAS number of (2,3-Dimethoxyphenyl)acetic acid?

The CAS number is 90-53-9.

How many hydrogen bond donor counts does (2,3-Dimethoxyphenyl)acetic acid have?

It has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does (2,3-Dimethoxyphenyl)acetic acid have?

It has 4 hydrogen bond acceptor counts.

What is the topological polar surface area of (2,3-Dimethoxyphenyl)acetic acid?

The topological polar surface area is 55.8 Ų.