--- Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C10H12O4.
The molecular weight of the compound is 196.20 g/mol.
The IUPAC name of the compound is 2-(2-methoxyphenoxy)propanoic acid.
The canonical SMILES notation for the compound is CC(C(=O)O)OC1=CC=CC=C1OC.
The compound has 1 hydrogen bond donor count.
The topological polar surface area of the compound is 55.8Ų.
The compound has 4 rotatable bond counts.
Yes, the compound is canonicalized.
The InChIKey for the compound is OPYAFQUFAKCNPN-UHFFFAOYSA-N.
The CAS number for the compound is 7309-51-5.