2,3,5,6-Tetrafluorobenzenethiol

• CAS: 769-40-4
• Catalog Number: ACM769404
• Category: Amines
• Molecular Weight: 182.14
• Hazard Statements: H302-H319
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 2,3,5,6-Tetrafluorobenzenethiol?

The molecular formula is C6H2F4S.

What is the molecular weight of 2,3,5,6-Tetrafluorobenzenethiol?

The molecular weight is 182.14 g/mol.

What is the IUPAC name of 2,3,5,6-Tetrafluorobenzenethiol?

The IUPAC name is 2,3,5,6-tetrafluorobenzenethiol.

What is the InChI of 2,3,5,6-Tetrafluorobenzenethiol?

The InChI is InChI=1S/C6H2F4S/c7-2-1-3(8)5(10)6(11)4(2)9/h1,11H.

What is the InChIKey of 2,3,5,6-Tetrafluorobenzenethiol?

The InChIKey is IGOGJHYWSOZGAE-UHFFFAOYSA-N.

What is the canonical SMILES of 2,3,5,6-Tetrafluorobenzenethiol?

The canonical SMILES is C1=C(C(=C(C(=C1F)F)S)F)F.

What is the CAS number of 2,3,5,6-Tetrafluorobenzenethiol?

The CAS number is 769-40-4.

What is the XLogP3 value of 2,3,5,6-Tetrafluorobenzenethiol?

The XLogP3 value is 2.6.

How many hydrogen bond acceptor counts does 2,3,5,6-Tetrafluorobenzenethiol have?

It has 5 hydrogen bond acceptor counts.