(1S,2R)-N-Boc-1-amino-2-indanol

• Catalog Number: ACMA00002417
• Category: Ethers
• Molecular Weight: 249.31
• Molecular Formula: C₁₄H₁₅NO
• Hazard Statements: H319
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of (1S,2R)-N-Boc-1-amino-2-indanol?

The molecular formula is C14H19NO3.

What is the molecular weight of (1S,2R)-N-Boc-1-amino-2-indanol?

The molecular weight is 249.30 g/mol.

What is the IUPAC name of (1S,2R)-N-Boc-1-amino-2-indanol?

The IUPAC name is tert-butyl N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]carbamate.

What is the InChI of (1S,2R)-N-Boc-1-amino-2-indanol?

The InChI is InChI=1S/C14H19NO3/c1-14(2,3)18-13(17)15-12-10-7-5-4-6-9(10)8-11(12)16/h4-7,11-12,16H,8H2,1-3H3,(H,15,17)/t11-,12+/m1/s1.

What is the InChIKey of (1S,2R)-N-Boc-1-amino-2-indanol?

The InChIKey is ROUONLKDWVQKNB-NEPJUHHUSA-N.

What is the canonical SMILES of (1S,2R)-N-Boc-1-amino-2-indanol?

The canonical SMILES is CC(C)(C)OC(=O)NC1C(CC2=CC=CC=C12)O.

How many hydrogen bond donor count does (1S,2R)-N-Boc-1-amino-2-indanol have?

It has 2 hydrogen bond donor counts.

How many hydrogen bond acceptor count does (1S,2R)-N-Boc-1-amino-2-indanol have?

It has 3 hydrogen bond acceptor counts.

What is the topological polar surface area of (1S,2R)-N-Boc-1-amino-2-indanol?

The topological polar surface area is 58.6Ų.

How many rotatable bond counts does (1S,2R)-N-Boc-1-amino-2-indanol have?

It has 3 rotatable bond counts.