tert-Butyl N-(1-benzyl-2-oxoethyl)carbamate

• Catalog Number: ACMA00002414
• Category: Ethers
• Molecular Weight: 249.31
• Molecular Formula: C₁₄H₁₇NO₄
• Hazard Statements: H302-H315-H318-H335-H412
• RIDADR: UN 2811 6.1 / PGIII
• Symbol: GHS05

Custom Q&A

What is the molecular formula of tert-Butyl N-(1-benzyl-2-oxoethyl)carbamate?

The molecular formula is C14H19NO3.

What is the molecular weight of tert-Butyl N-(1-benzyl-2-oxoethyl)carbamate?

The molecular weight is 249.30 g/mol.

What is the IUPAC name of tert-Butyl N-(1-benzyl-2-oxoethyl)carbamate?

The IUPAC name is tert-butyl N-(1-oxo-3-phenylpropan-2-yl)carbamate.

What is the InChI of tert-Butyl N-(1-benzyl-2-oxoethyl)carbamate?

The InChI is InChI=1S/C14H19NO3/c1-14(2,3)18-13(17)15-12(10-16)9-11-7-5-4-6-8-11/h4-8,10,12H,9H2,1-3H3,(H,15,17).

What is the InChIKey of tert-Butyl N-(1-benzyl-2-oxoethyl)carbamate?

The InChIKey is ZJTYRNPLVNMVPQ-UHFFFAOYSA-N.

What is the canonical SMILES of tert-Butyl N-(1-benzyl-2-oxoethyl)carbamate?

The canonical SMILES is CC(C)(C)OC(=O)NC(CC1=CC=CC=C1)C=O.

What is the CAS number of tert-Butyl N-(1-benzyl-2-oxoethyl)carbamate?

The CAS number is 103127-53-3.

What is the XLogP3-AA value of tert-Butyl N-(1-benzyl-2-oxoethyl)carbamate?

The XLogP3-AA value is 2.5.

How many hydrogen bond donor counts does tert-Butyl N-(1-benzyl-2-oxoethyl)carbamate have?

It has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does tert-Butyl N-(1-benzyl-2-oxoethyl)carbamate have?

It has 3 hydrogen bond acceptor counts.