1-Bromo-4-tert-butoxybenzene

• Catalog Number: ACMA00002017
• Category: Ethers
• Molecular Weight: 229.11
• Molecular Formula: C₁₀H₁₂O₄
• Hazard Statements: H302-H319
• RIDADR: UN 3261 8 / PGII
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 1-Bromo-4-tert-butoxybenzene?

The molecular formula is C10H13BrO.

What is the molecular weight of 1-Bromo-4-tert-butoxybenzene?

The molecular weight is 229.11 g/mol.

What is the IUPAC name of 1-Bromo-4-tert-butoxybenzene?

The IUPAC name is 1-bromo-4-[(2-methylpropan-2-yl)oxy]benzene.

What is the InChI of 1-Bromo-4-tert-butoxybenzene?

The InChI is InChI=1S/C10H13BrO/c1-10(2,3)12-9-6-4-8(11)5-7-9/h4-7H,1-3H3.

What is the InChIKey of 1-Bromo-4-tert-butoxybenzene?

The InChIKey is QIWQHUCUWNGYDZ-UHFFFAOYSA-N.

What is the canonical SMILES of 1-Bromo-4-tert-butoxybenzene?

The canonical SMILES is CC(C)(C)OC1=CC=C(C=C1)Br.

What is the CAS number of 1-Bromo-4-tert-butoxybenzene?

The CAS number is 60876-70-2.

What is the EC number of 1-Bromo-4-tert-butoxybenzene?

The EC number is 641-192-1.

What is the DSSTox Substance ID of 1-Bromo-4-tert-butoxybenzene?

The DSSTox Substance ID is DTXSID20377221.

Is 1-Bromo-4-tert-butoxybenzene considered to be a canonicalized compound?

Yes, 1-Bromo-4-tert-butoxybenzene is considered a canonicalized compound.