3-Ethoxy-4-methoxybenzoic acid

• Catalog Number: ACMA00002020
• Category: Ethers
• Molecular Weight: 196.20
• Molecular Formula: C₁₀H₁₂O₄
• Hazard Statements: H302
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 3-Ethoxy-4-methoxybenzoic acid?

The molecular formula of 3-Ethoxy-4-methoxybenzoic acid is C10H12O4.

What are the synonyms of 3-Ethoxy-4-methoxybenzoic acid?

The synonyms of 3-Ethoxy-4-methoxybenzoic acid are 2651-55-0, Benzoic acid, 3-ethoxy-4-methoxy-, Maybridge1_005010, Benzoic acid, 3-ethoxy-4-methoxy-, and more.

What is the molecular weight of 3-Ethoxy-4-methoxybenzoic acid?

The molecular weight of 3-Ethoxy-4-methoxybenzoic acid is 196.20 g/mol.

What is the IUPAC name of 3-Ethoxy-4-methoxybenzoic acid?

The IUPAC name of 3-Ethoxy-4-methoxybenzoic acid is 3-ethoxy-4-methoxybenzoic acid.

What is the InChI of 3-Ethoxy-4-methoxybenzoic acid?

The InChI of 3-Ethoxy-4-methoxybenzoic acid is InChI=1S/C10H12O4/c1-3-14-9-6-7(10(11)12)4-5-8(9)13-2/h4-6H,3H2,1-2H3,(H,11,12).

What is the InChIKey of 3-Ethoxy-4-methoxybenzoic acid?

The InChIKey of 3-Ethoxy-4-methoxybenzoic acid is DMSAIFTWQMXOBE-UHFFFAOYSA-N.

What is the canonical SMILES of 3-Ethoxy-4-methoxybenzoic acid?

The canonical SMILES of 3-Ethoxy-4-methoxybenzoic acid is CCOC1=C(C=CC(=C1)C(=O)O)OC.

What is the XLogP3 value of 3-Ethoxy-4-methoxybenzoic acid?

The XLogP3 value of 3-Ethoxy-4-methoxybenzoic acid is 2.

How many hydrogen bond donor count does 3-Ethoxy-4-methoxybenzoic acid have?

3-Ethoxy-4-methoxybenzoic acid has 1 hydrogen bond donor count.

How many hydrogen bond acceptor count does 3-Ethoxy-4-methoxybenzoic acid have?

3-Ethoxy-4-methoxybenzoic acid has 4 hydrogen bond acceptor count.