1-Bromo-4-methoxynaphthalene

• Catalog Number: ACMA00002211
• Category: Ethers
• Molecular Weight: 237.09
• Molecular Formula: C₁₂H₂₃NO₄
• Hazard Statements: H302
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 1-Bromo-4-methoxynaphthalene?

The molecular formula is C11H9BrO.

What is the molecular weight of 1-Bromo-4-methoxynaphthalene?

The molecular weight is 237.09 g/mol.

What is the IUPAC name of 1-Bromo-4-methoxynaphthalene?

The IUPAC name is 1-bromo-4-methoxynaphthalene.

What is the InChI code of 1-Bromo-4-methoxynaphthalene?

The InChI code is InChI=1S/C11H9BrO/c1-13-11-7-6-10(12)8-4-2-3-5-9(8)11/h2-7H,1H3.

What is the InChIKey code of 1-Bromo-4-methoxynaphthalene?

The InChIKey code is XURSAEHRFFSJED-UHFFFAOYSA-N.

What is the Canonical SMILES of 1-Bromo-4-methoxynaphthalene?

The Canonical SMILES is COC1=CC=C(C2=CC=CC=C21)Br.

What is the CAS number of 1-Bromo-4-methoxynaphthalene?

The CAS number is 5467-58-3.

What is the EC number of 1-Bromo-4-methoxynaphthalene?

The EC number is 802-059-5.

What is the DSSTox Substance ID of 1-Bromo-4-methoxynaphthalene?

The DSSTox Substance ID is DTXSID30203128.

Is 1-Bromo-4-methoxynaphthalene considered as a canonicalized compound?

Yes, 1-Bromo-4-methoxynaphthalene is considered as a canonicalized compound.