What is the molecular formula of 1,4-dihydro-chromeno[4,3-c]pyrazole-3-carboxylic acid?
The molecular formula is C11H8N2O3.
What is the molecular weight of 1,4-dihydro-chromeno[4,3-c]pyrazole-3-carboxylic acid?
The molecular weight is 216.19 g/mol.
What is the IUPAC name of 1,4-dihydro-chromeno[4,3-c]pyrazole-3-carboxylic acid?
The IUPAC name is 2,4-dihydrochromeno[4,3-c]pyrazole-3-carboxylic acid.
What is the InChI of 1,4-dihydro-chromeno[4,3-c]pyrazole-3-carboxylic acid?
The InChI is InChI=1S/C11H8N2O3/c14-11(15)10-7-5-16-8-4-2-1-3-6(8)9(7)12-13-10/h1-4H,5H2,(H,12,13)(H,14,15).
What is the InChIKey of 1,4-dihydro-chromeno[4,3-c]pyrazole-3-carboxylic acid?
The InChIKey is LCCZBCRICIYZCV-UHFFFAOYSA-N.
What is the canonical SMILES of 1,4-dihydro-chromeno[4,3-c]pyrazole-3-carboxylic acid?
The canonical SMILES is C1C2=C(NN=C2C3=CC=CC=C3O1)C(=O)O.
What is the XLogP3-AA value of 1,4-dihydro-chromeno[4,3-c]pyrazole-3-carboxylic acid?
The XLogP3-AA value is 1.3.
How many hydrogen bond donor counts does 1,4-dihydro-chromeno[4,3-c]pyrazole-3-carboxylic acid have?
It has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 1,4-dihydro-chromeno[4,3-c]pyrazole-3-carboxylic acid have?
It has 4 hydrogen bond acceptor counts.
How many rotatable bond counts does 1,4-dihydro-chromeno[4,3-c]pyrazole-3-carboxylic acid have?
It has 1 rotatable bond count.