CAS
--- Purity
---
--- Purity
---
Shopping basket
1-[(Ammoniooxy)methyl]-4-fluorobenzene chloride
Catalog Number
ACMA00002573
Category
Ethers
Molecular Weight
177.60
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Hazard Statements
H302-H319
RIDADR
NONH for all modes of transport
Symbol
GHS07
What is the molecular formula of the compound?
The molecular formula is C7H9ClFNO.
How much does the compound weigh?
The compound has a molecular weight of 177.60 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is O-[(4-fluorophenyl)methyl]hydroxylamine hydrochloride.
What is the InChI code of the compound?
The InChI code of the compound is InChI=1S/C7H8FNO.ClH/c8-7-3-1-6(2-4-7)5-10-9;/h1-4H,5,9H2;1H.
What is the InChIKey of the compound?
The InChIKey of the compound is YZNDOVGYWWHJBB-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is C1=CC(=CC=C1CON)F.Cl.
What is the CAS number of the compound?
The CAS number of the compound is 51572-89-5.
What is the European Community (EC) number of the compound?
The European Community (EC) number of the compound is 671-550-2.
How many hydrogen bond donor counts does the compound have?
The compound has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does the compound have?
The compound has 3 hydrogen bond acceptor counts.
Recommended Products
