CAS
--- Purity
---
--- Purity
---
Shopping basket
1-[(Ammoniooxy)methyl]-3-chlorobenzenechloride
Catalog Number
ACMA00002574
Category
Ethers
Molecular Weight
194.06
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Hazard Statements
H226
RIDADR
NONH for all modes of transport
Symbol
GHS02
What is the molecular formula of the compound?
The molecular formula of the compound is C7H9Cl2NO.
What is the molecular weight of the compound?
The molecular weight of the compound is 194.06 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is O-[(3-chlorophenyl)methyl]hydroxylamine;hydrochloride.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C7H8ClNO.ClH/c8-7-3-1-2-6(4-7)5-10-9;/h1-4H,5,9H2;1H.
What is the InChIKey of the compound?
The InChIKey of the compound is PZPCEIVCWGWHCC-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is C1=CC(=CC(=C1)Cl)CON.Cl.
What is the CAS number of the compound?
The CAS number of the compound is 29605-78-5.
What is the ChEMBL ID of the compound?
The ChEMBL ID of the compound is CHEMBL3765807.
What is the hydrogen bond donor count of the compound?
The hydrogen bond donor count of the compound is 2.
What is the hydrogen bond acceptor count of the compound?
The hydrogen bond acceptor count of the compound is 2.
Recommended Products
