CAS
--- Purity
---
--- Purity
---
Shopping basket
1-Amino-2-butanol
Catalog Number
ACMA00001259
Category
Amines
Molecular Weight
89.14
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Hazard Statements
H225-H302 + H332-H314
RIDADR
UN3286 - class 3 - PG 2 - RQ - EHS - basic - Flammable liquid, toxic, corrosive, n.o.s., Hi:ALL(not BR)
Symbol
GHS02
What is the molecular formula of 1-Amino-2-butanol?
The molecular formula of 1-Amino-2-butanol is C4H11NO.
What is the molecular weight of 1-Amino-2-butanol?
The molecular weight of 1-Amino-2-butanol is 89.14 g/mol.
What is the IUPAC name of 1-Amino-2-butanol?
The IUPAC name of 1-Amino-2-butanol is 1-aminobutan-2-ol.
What is the InChI code of 1-Amino-2-butanol?
The InChI code of 1-Amino-2-butanol is InChI=1S/C4H11NO/c1-2-4(6)3-5/h4,6H,2-3,5H2,1H3.
What is the InChIKey of 1-Amino-2-butanol?
The InChIKey of 1-Amino-2-butanol is KODLUXHSIZOKTG-UHFFFAOYSA-N.
What is the CAS number of 1-Amino-2-butanol?
The CAS number of 1-Amino-2-butanol is 13552-21-1.
What is the UN number of 1-Amino-2-butanol?
The UN number of 1-Amino-2-butanol is 2735.
What is the hydrogen bond donor count of 1-Amino-2-butanol?
The hydrogen bond donor count of 1-Amino-2-butanol is 2.
What is the hydrogen bond acceptor count of 1-Amino-2-butanol?
The hydrogen bond acceptor count of 1-Amino-2-butanol is 2.
What is the formal charge of 1-Amino-2-butanol?
The formal charge of 1-Amino-2-butanol is 0.
Recommended Products
