1,4-Dioxa-spiro[4.5]dec-8-ylamine

• Catalog Number: ACMA00002700
• Category: Ethers
• Molecular Weight: 157.21
• Molecular Formula: C₈H₁₂ClNO₂
• Hazard Statements: H302
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 1,4-Dioxa-spiro[4.5]dec-8-ylamine?

The molecular formula of 1,4-Dioxa-spiro[4.5]dec-8-ylamine is C8H15NO2.

What is the molecular weight of 1,4-Dioxa-spiro[4.5]dec-8-ylamine?

The molecular weight of 1,4-Dioxa-spiro[4.5]dec-8-ylamine is 157.21 g/mol.

What is the IUPAC name of 1,4-Dioxa-spiro[4.5]dec-8-ylamine?

The IUPAC name of 1,4-Dioxa-spiro[4.5]dec-8-ylamine is 1,4-dioxaspiro[4.5]decan-8-amine.

What is the InChI of 1,4-Dioxa-spiro[4.5]dec-8-ylamine?

The InChI of 1,4-Dioxa-spiro[4.5]dec-8-ylamine is InChI=1S/C8H15NO2/c9-7-1-3-8(4-2-7)10-5-6-11-8/h7H,1-6,9H2.

What is the InChIKey of 1,4-Dioxa-spiro[4.5]dec-8-ylamine?

The InChIKey of 1,4-Dioxa-spiro[4.5]dec-8-ylamine is KDAFVGCPLFJMHY-UHFFFAOYSA-N.

What is the canonical SMILES of 1,4-Dioxa-spiro[4.5]dec-8-ylamine?

The canonical SMILES of 1,4-Dioxa-spiro[4.5]dec-8-ylamine is C1CC2(CCC1N)OCCO2.

What is the CAS number of 1,4-Dioxa-spiro[4.5]dec-8-ylamine?

The CAS number of 1,4-Dioxa-spiro[4.5]dec-8-ylamine is 97096-16-7.

What is the EC number of 1,4-Dioxa-spiro[4.5]dec-8-ylamine?

The EC number of 1,4-Dioxa-spiro[4.5]dec-8-ylamine is 689-746-1.

What is the DSSTox Substance ID of 1,4-Dioxa-spiro[4.5]dec-8-ylamine?

The DSSTox Substance ID of 1,4-Dioxa-spiro[4.5]dec-8-ylamine is DTXSID60562412.

Is 1,4-Dioxa-spiro[4.5]dec-8-ylamine a canonicalized compound?

Yes, 1,4-Dioxa-spiro[4.5]dec-8-ylamine is a canonicalized compound.