1-[1-(Methoxymethyl)cyclopentyl]methanamine hydrochloride

• Catalog Number: ACMA00002699
• Category: Ethers
• Molecular Weight: 179.69
• Molecular Formula: C₈H₁₂ClNO₂
• Hazard Statements: H302 + H312 + H332-H317-H341-H351-H410
• RIDADR: UN 3334
• Symbol: GHS07

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C8H18ClNO.

What is the molecular weight of the compound?

The molecular weight of the compound is 179.69 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is [1-(methoxymethyl)cyclopentyl]methanamine hydrochloride.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C8H17NO.ClH/c1-10-7-8(6-9)4-2-3-5-8;/h2-7,9H2,1H3;1H.

What is the InChIKey of the compound?

The InChIKey of the compound is SCNYSYJSFFEXSN-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is COCC1(CCCC1)CN.Cl.

What is the CAS number of the compound?

The CAS number of the compound is 1255718-08-1.

What is the hydrogen bond donor count of the compound?

The hydrogen bond donor count of the compound is 2.

What is the hydrogen bond acceptor count of the compound?

The hydrogen bond acceptor count of the compound is 2.

Is the compound canonicalized?

Yes, the compound is canonicalized.