1,3-Dimethyl-2-oxo-2,3-dihydro-1H-benzimidazole-5-carbaldehyde

• Catalog Number: ACMA00000891
• Category: Amines
• Molecular Weight: 190.20
• Molecular Formula: C₁₀H₁₀N₂
• Hazard Statements: H319
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 1,3-Dimethyl-2-oxo-2,3-dihydro-1H-benzimidazole-5-carbaldehyde?

The molecular formula is C10H10N2O2.

What is the molecular weight of 1,3-Dimethyl-2-oxo-2,3-dihydro-1H-benzimidazole-5-carbaldehyde?

The molecular weight is 190.20 g/mol.

What is the IUPAC name of 1,3-Dimethyl-2-oxo-2,3-dihydro-1H-benzimidazole-5-carbaldehyde?

The IUPAC name is 1,3-dimethyl-2-oxobenzimidazole-5-carbaldehyde.

What is the InChI code of 1,3-Dimethyl-2-oxo-2,3-dihydro-1H-benzimidazole-5-carbaldehyde?

The InChI code is InChI=1S/C10H10N2O2/c1-11-8-4-3-7(6-13)5-9(8)12(2)10(11)14/h3-6H,1-2H3.

What is the InChIKey of 1,3-Dimethyl-2-oxo-2,3-dihydro-1H-benzimidazole-5-carbaldehyde?

The InChIKey is PFRNWHRHGONGPG-UHFFFAOYSA-N.

What is the canonical SMILES of 1,3-Dimethyl-2-oxo-2,3-dihydro-1H-benzimidazole-5-carbaldehyde?

The canonical SMILES is CN1C2=C(C=C(C=C2)C=O)N(C1=O)C.

What is the CAS number of 1,3-Dimethyl-2-oxo-2,3-dihydro-1H-benzimidazole-5-carbaldehyde?

The CAS number is 55241-49-1.

How many hydrogen bond donor counts are there in 1,3-Dimethyl-2-oxo-2,3-dihydro-1H-benzimidazole-5-carbaldehyde?

There are 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts are there in 1,3-Dimethyl-2-oxo-2,3-dihydro-1H-benzimidazole-5-carbaldehyde?

There are 2 hydrogen bond acceptor counts.