Triethyl orthoformate-d1

• CAS: 26387-53-1
• Catalog Number: ACM26387531
• Category: Other Products
• Molecular Weight: 149.206301778
• Molecular Formula: C₇H₁₅DO₃
• Synonyms: TRIETHYL ORTHOFORMATE-D1

Custom Q&A

What is the molecular formula of Triethyl orthoformate-d1?

The molecular formula of Triethyl orthoformate-d1 is C7H16O3.

What is the molecular weight of Triethyl orthoformate-d1?

The molecular weight of Triethyl orthoformate-d1 is 148.20 g/mol.

What is the structure of Triethyl orthoformate-d1?

Triethyl orthoformate-d1 appears as a clear, colorless liquid with a pungent odor.

What are some synonyms for Triethyl orthoformate-d1?

Some synonyms for Triethyl orthoformate-d1 include Triethyl orthoformate, Triethoxymethane, and ETHYL ORTHOFORMATE.

What is the InChI of Triethyl orthoformate-d1?

The InChI of Triethyl orthoformate-d1 is InChI=1S/C7H16O3/c1-4-8-7(9-5-2)10-6-3/h7H,4-6H2,1-3H3.

What is the Canonical SMILES of Triethyl orthoformate-d1?

The Canonical SMILES of Triethyl orthoformate-d1 is CCOC(OCC)OCC.

How many hydrogen bond acceptor counts does Triethyl orthoformate-d1 have?

Triethyl orthoformate-d1 has 3 hydrogen bond acceptor counts.

What is the topological polar surface area of Triethyl orthoformate-d1?

The topological polar surface area of Triethyl orthoformate-d1 is 27.7 Å2.

How many rotatable bond counts does Triethyl orthoformate-d1 have?

Triethyl orthoformate-d1 has 6 rotatable bond counts.

Is Triethyl orthoformate-d1 more or less dense than water?

Triethyl orthoformate-d1 is less dense than water.