Tenofovir diphosphate

• CAS: 166403-66-3
• Catalog Number: ACM166403663
• Category: Other Products
• Molecular Weight: 447.17
• Molecular Formula: C₉H₁₆N₅O₁₀P₃
• Synonyms: TENOFOVIR DIPHOSPHATE;PMPApp;(R)-Diphosphoric acid monoanhydride with [[2-(6-amino-9H-purin-9-yl)-1-methylethoxy]methyl]phosphonic acid

Custom Q&A

What is the molecular formula of Tenofovir diphosphate?

The molecular formula of Tenofovir diphosphate is C9H16N5O10P3.

What is the molecular weight of Tenofovir diphosphate?

The molecular weight of Tenofovir diphosphate is 447.17 g/mol.

What is the IUPAC name of Tenofovir diphosphate?

The IUPAC name of Tenofovir diphosphate is [(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[hydroxy(phosphonooxy)phosphoryl]oxyphosphinic acid.

What is the InChI of Tenofovir diphosphate?

The InChI of Tenofovir diphosphate is InChI=1S/C9H16N5O10P3/c1-6(2-14-4-13-7-8(10)11-3-12-9(7)14)22-5-25(15,16)23-27(20,21)24-26(17,18)19/h3-4,6H,2,5H2,1H3,(H,15,16)(H,20,21)(H2,10,11,12)(H2,17,18,19)/t6-/m1/s1.

What is the Canonical SMILES of Tenofovir diphosphate?

The Canonical SMILES of Tenofovir diphosphate is CC(CN1C=NC2=C(N=CN=C21)N)OCP(=O)(O)OP(=O)(O)OP(=O)(O)O.

What is the CAS number of Tenofovir diphosphate?

The CAS number of Tenofovir diphosphate is 166403-66-3.

How many hydrogen bond donor counts are there in Tenofovir diphosphate?

There are 5 hydrogen bond donor counts in Tenofovir diphosphate.

How many hydrogen bond acceptor counts are there in Tenofovir diphosphate?

There are 14 hydrogen bond acceptor counts in Tenofovir diphosphate.

What is the topological polar surface area of Tenofovir diphosphate?

The topological polar surface area of Tenofovir diphosphate is 229 Ų.

How many rotatable bond counts are there in Tenofovir diphosphate?

There are 9 rotatable bond counts in Tenofovir diphosphate.