Temocillin Disodium

• CAS: 61545-06-0
• Catalog Number: ACM61545060
• Category: Main Products
• Molecular Weight: 458.42
• Molecular Formula: C16H16N2Na2O7S2
• Synonyms: (2S,5R,6S)-6-[(Carboxy-3-thienylacetyl)amino]-6-methoxy-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic Acid Disodium Salt
• Appearance: Powder

Custom Q&A

What is the molecular formula of temocillin?

The molecular formula of temocillin is C16H18N2O7S2.

What is the molecular weight of temocillin?

The molecular weight of temocillin is 414.5 g/mol.

What is the IUPAC name of temocillin?

The IUPAC name of temocillin is (2S,5R,6S)-6-[(2-carboxy-2-thiophen-3-ylacetyl)amino]-6-methoxy-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.

What is the InChI key of temocillin?

The InChI key of temocillin is BVCKFLJARNKCSS-DWPRYXJFSA-N.

What is the canonical SMILES of temocillin?

The canonical SMILES of temocillin is CC1(C(N2C(S1)C(C2=O)(NC(=O)C(C3=CSC=C3)C(=O)O)OC)C(=O)O)C.

What is the CAS number of temocillin?

The CAS number of temocillin is 66148-78-5.

What is the EC number of temocillin?

The European Community (EC) number of temocillin is 266-184-1.

What is the UNII number of temocillin?

The UNII number of temocillin is 03QB156W6I.

What is the ChEMBL ID of temocillin?

The ChEMBL ID of temocillin is CHEMBL1276310.

What is the XLogP3-AA value of temocillin?

The XLogP3-AA value of temocillin is 1.1.

What is the molecular formula of Temocillin according to the reference?

The molecular formula of Temocillin is C16H18N2O7S2.

When was Temocillin created and modified?

Temocillin was created on 2005-08-09 and modified on 2023-12-30.

What is Temocillin's IUPAC Name?

Temocillin's IUPAC Name is (2S,5R,6S)-6-[(2-carboxy-2-thiophen-3-ylacetyl)amino]-6-methoxy-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.

How does Temocillin work as an antibiotic?

Temocillin binds to and inactivates penicillin-binding proteins (PBPs) located on the inner membrane of the bacterial cell wall, interfering with cell wall synthesis and leading to cell lysis.

What is Temocillin's InChIKey?

Temocillin's InChIKey is BVCKFLJARNKCSS-DWPRYXJFSA-N.

What is Temocillin's Canonical SMILES?

Temocillin's Canonical SMILES is CC1(C(N2C(S1)C(C2=O)(NC(=O)C(C3=CSC=C3)C(=O)O)OC)C(=O)O)C.

What is Temocillin's CAS number?

Temocillin's CAS number is 66148-78-5.

How many hydrogen bond donor counts does Temocillin have?

Temocillin has 3 hydrogen bond donor counts.

What is Temocillin's ChEMBL ID?

Temocillin's ChEMBL ID is CHEMBL1276310.