Soyasapogenol b(p)

• CAS: 595-15-3
• Catalog Number: ACM595153
• Category: Other Products
• Molecular Weight: 458.722
• Molecular Formula: C₃₀H₅₀O₃
• Synonyms: SOYASAPOGENOL B(P);(4S)-Olean-12-ene-3β,22β,24-triol;Sapogenol B;(3S,4S,4aR,6aR,6bS,8aR,9R,12aS,14aR,14bR)-4-(hydroxymethyl)-4,6a,6b,8a,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicene-3,9-diol;(3S,4S,4aR,6aR,6bS,8aR,9R,12aS,14aR,14bR)-4,6a,6b,8a,11,11,14b-heptamethyl-4-methylol-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicene-3,9-diol;Soyasapogel B;Soyasapogenol M2

Custom Q&A

What is the molecular formula of Soyasapogenol B?

The molecular formula of Soyasapogenol B is C30H50O3.

What is the molecular weight of Soyasapogenol B?

The molecular weight of Soyasapogenol B is 458.7 g/mol.

What are some synonyms for Soyasapogenol B?

Some synonyms for Soyasapogenol B include soyasapogenol B, 24-hydroxysophoradiol, soyasapogenin B, and soyasapogenol-B.

What is the IUPAC Name of Soyasapogenol B?

The IUPAC Name of Soyasapogenol B is (3S,4S,4aR,6aR,6bS,8aR,9R,12aS,14aR,14bR)-4-(hydroxymethyl)-4,6a,6b,8a,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicene-3,9-diol.

What is the InChI of Soyasapogenol B?

The InChI of Soyasapogenol B is InChI=1S/C30H50O3/c1-25(2)16-20-19-8-9-22-27(4)12-11-23(32)28(5,18-31)21(27)10-13-30(22,7)29(19,6)15-14-26(20,3)24(33)17-25/h8,20-24,31-33H,9-18H2,1-7H3/t20-,21+,22+,23-,24+,26+,27-,28+,29+,30+/m0/s1.

What are some identifiers for Soyasapogenol B?

Some identifiers for Soyasapogenol B include CAS number 595-15-3, UNII 1EZ10D7E2F, and ChEMBL ID CHEMBL1762007.

What are some computed properties of Soyasapogenol B?

Some computed properties of Soyasapogenol B include XLogP3-AA at 7, Hydrogen Bond Donor Count of 3, and Heavy Atom Count of 33.

Where is Soyasapogenol B found naturally?

Soyasapogenol B is a natural product found in Astragalus mongholicus, Melilotus messanensis, and other organisms with data available.

When was Soyasapogenol B created and last modified?

Soyasapogenol B was created on June 24, 2005, and last modified on December 30, 2023.

What is the Canonical SMILES of Soyasapogenol B?

The Canonical SMILES of Soyasapogenol B is CC1(CC2C3=CCC4C5(CCC(C(C5CCC4(C3(CCC2(C(C1)O)C)C)C)(C)CO)O)C)C.