(S)-3-(3-Bromophenyl)-2-(tert-butoxycarbonylamino)propanoic acid

• CAS: 82278-73-7
• Catalog Number: ACM82278737
• Category: Bromine Series

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C14H18BrNO4.

What is the molecular weight of the compound?

The molecular weight of the compound is 344.20 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is (2S)-3-(3-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.

What is the CAS number of the compound?

The CAS number of the compound is 82278-73-7.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C14H18BrNO4/c1-14(2,3)20-13(19)16-11(12(17)18)8-9-5-4-6-10(15)7-9/h4-7,11H,8H2,1-3H3,(H,16,19)(H,17,18)/t11-/m0/s1.

What is the InChIKey of the compound?

The InChIKey of the compound is FBUDYESOPLBQIR-NSHDSACASA-N.

What is the Canonical SMILES of the compound?

The Canonical SMILES of the compound is CC(C)(C)OC(=O)NC(CC1=CC(=CC=C1)Br)C(=O)O.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value of the compound is 3.2.

What is the hydrogen bond donor count of the compound?

The hydrogen bond donor count of the compound is 2.

Is the compound covalently-bonded?

Yes, the compound is covalently-bonded.