6865-35-6 Purity
60%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of Rhodamine B hydrazide is C28H32N4O2.
Rhodamine B hydrazide was created on 2005-09-13 and last modified on 2023-12-30.
The InChIKey of Rhodamine B hydrazide is WTDHTIVYKKLOTC-UHFFFAOYSA-N.
The molecular weight of Rhodamine B hydrazide is 456.6 g/mol.
The Canonical SMILES of Rhodamine B hydrazide is CCN(CC)C1=CC2=C(C=C1)C3(C4=C(O2)C=C(C=C4)N(CC)CC)C5=CC=CC=C5C(=O)N3N.
The European Community (EC) Number for Rhodamine B hydrazide is 634-768-9.
Rhodamine B hydrazide has 5 hydrogen bond acceptor counts.
The XLogP3-AA value of Rhodamine B hydrazide is 4.7.
The topological polar surface area of Rhodamine B hydrazide is 62?2.
Yes, Rhodamine B hydrazide is a canonicalized compound.