Rhodamine 116 perchlorate

CAS

62669-77-6

Catalog Number

ACM62669776

Category

Other Products

Molecular Weight

458.85

Molecular Formula

C₂₂H₁₉ClN₂O₇

MSDS COA Spec Sheet

If you have any other questions or need other size, please get a quote.

Specification

Synonyms

2-(6-(methylamino)-3-(methylimino)-3h-xanthen-9-yl)benzoicacidmonoperchlora;2-(6-(methylamino)-3-(methylimino)-3h-xanthen-9-yl)-benzoicacimonoperch;9-(2-carboxyphenyl)-3,6-bis(methylamino)xanthyliumperchlorate;lorate;rh116;rhodamine116;RHODAMIN 116 PERCHLORATE;RHODAMINE 116 PERCHLORATE

Hazard Statements

Safety Description

22-24/25

What is the molecular formula of Rhodamine 116 perchlorate?

The molecular formula of Rhodamine 116 perchlorate is C22H19ClN2O7.

What is the molecular weight of Rhodamine 116 perchlorate?

The molecular weight of Rhodamine 116 perchlorate is 458.8 g/mol.

What is the IUPAC name of Rhodamine 116 perchlorate?

The IUPAC name of Rhodamine 116 perchlorate is [9-(2-carboxyphenyl)-6-(methylamino)xanthen-3-ylidene]-methylazanium;perchlorate.

What is the InChI of Rhodamine 116 perchlorate?

The InChI of Rhodamine 116 perchlorate is InChI=1S/C22H18N2O3.ClHO4/c1-23-13-7-9-17-19(11-13)27-20-12-14(24-2)8-10-18(20)21(17)15-5-3-4-6-16(15)22(25)26;2-1(3,4)5/h3-12,23H,1-2H3,(H,25,26);(H,2,3,4,5).

What is the InChIKey of Rhodamine 116 perchlorate?

The InChIKey of Rhodamine 116 perchlorate is PGRMUEVKABEERE-UHFFFAOYSA-N.

What is the canonical SMILES of Rhodamine 116 perchlorate?

The canonical SMILES of Rhodamine 116 perchlorate is CNC1=CC2=C(C=C1)C(=C3C=CC(=[NH+]C)C=C3O2)C4=CC=CC=C4C(=O)O.[O-]Cl(=O)(=O)=O.

What is the CAS number of Rhodamine 116 perchlorate?

The CAS number of Rhodamine 116 perchlorate is 62669-77-6.

What is the hydrogen bond donor count of Rhodamine 116 perchlorate?

The hydrogen bond donor count of Rhodamine 116 perchlorate is 3.

What is the hydrogen bond acceptor count of Rhodamine 116 perchlorate?

The hydrogen bond acceptor count of Rhodamine 116 perchlorate is 8.

What is the rotatable bond count of Rhodamine 116 perchlorate?

The rotatable bond count of Rhodamine 116 perchlorate is 3.