(R)-N-Boc-4-bromophenylalanine

• CAS: 79561-82-3
• Catalog Number: ACM79561823
• Category: Bromine Series
• Molecular Weight: 344.2
• Molecular Formula: C₁₄H₁₈BrNO₄
• Appearance: off-white crystalline powder

Custom Q&A

What is the molecular formula of (R)-N-Boc-4-bromophenylalanine?

The molecular formula is C14H17BrNO4.

What is the molecular weight of (R)-N-Boc-4-bromophenylalanine?

The molecular weight is 343.19 g/mol.

What is the IUPAC name of (R)-N-Boc-4-bromophenylalanine?

The IUPAC name is (2R)-3-(4-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.

What is the InChI of (R)-N-Boc-4-bromophenylalanine?

The InChI is InChI=1S/C14H18BrNO4/c1-14(2,3)20-13(19)16-11(12(17)18)8-9-4-6-10(15)7-5-9/h4-7,11H,8H2,1-3H3,(H,16,19)(H,17,18)/p-1/t11-/m1/s1.

What is the InChIKey of (R)-N-Boc-4-bromophenylalanine?

The InChIKey is ULNOXUAEIPUJMK-LLVKDONJSA-M.

What is the canonical SMILES of (R)-N-Boc-4-bromophenylalanine?

The canonical SMILES is CC(C)(C)OC(=O)NC(CC1=CC=C(C=C1)Br)C(=O)[O-].

What is the isomeric SMILES of (R)-N-Boc-4-bromophenylalanine?

The isomeric SMILES is CC(C)(C)OC(=O)N[C@H](CC1=CC=C(C=C1)Br)C(=O)[O-].

What is the XLogP3 value of (R)-N-Boc-4-bromophenylalanine?

The XLogP3 value is 3.1.

How many hydrogen bond donor counts are there in (R)-N-Boc-4-bromophenylalanine?

There is 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts are there in (R)-N-Boc-4-bromophenylalanine?

There are 4 hydrogen bond acceptor counts.