(R)-N-BOC-3-Bromophenylalanine

• CAS: 261360-77-4
• Catalog Number: ACM261360774
• Category: Bromine Series

Custom Q&A

What is the molecular formula of (R)-N-BOC-3-Bromophenylalanine?

The molecular formula of (R)-N-BOC-3-Bromophenylalanine is C14H18BrNO4.

What is the molecular weight of (R)-N-BOC-3-Bromophenylalanine?

The molecular weight of (R)-N-BOC-3-Bromophenylalanine is 344.20 g/mol.

What is the IUPAC name of (R)-N-BOC-3-Bromophenylalanine?

The IUPAC name of (R)-N-BOC-3-Bromophenylalanine is (2R)-3-(3-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.

What is the InChI of (R)-N-BOC-3-Bromophenylalanine?

The InChI of (R)-N-BOC-3-Bromophenylalanine is InChI=1S/C14H18BrNO4/c1-14(2,3)20-13(19)16-11(12(17)18)8-9-5-4-6-10(15)7-9/h4-7,11H,8H2,1-3H3,(H,16,19)(H,17,18)/t11-/m1/s1.

What is the InChIKey of (R)-N-BOC-3-Bromophenylalanine?

The InChIKey of (R)-N-BOC-3-Bromophenylalanine is FBUDYESOPLBQIR-LLVKDONJSA-N.

What is the canonical SMILES of (R)-N-BOC-3-Bromophenylalanine?

The canonical SMILES of (R)-N-BOC-3-Bromophenylalanine is CC(C)(C)OC(=O)NC(CC1=CC(=CC=C1)Br)C(=O)O.

What is the XLogP3-AA value of (R)-N-BOC-3-Bromophenylalanine?

The XLogP3-AA value of (R)-N-BOC-3-Bromophenylalanine is 3.2.

How many hydrogen bond donor counts does (R)-N-BOC-3-Bromophenylalanine have?

(R)-N-BOC-3-Bromophenylalanine has 2 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does (R)-N-BOC-3-Bromophenylalanine have?

(R)-N-BOC-3-Bromophenylalanine has 4 hydrogen bond acceptor counts.