(R)-BoroAbu-(+)-Pinanediol

• CAS: 208521-42-0
• Catalog Number: ACM208521420
• Category: Boro-Amino Acids
• Molecular Formula: C₁₃H₂₄BNO₂

Custom Q&A

What is the PubChem CID for Lithium L-lactate?

The PubChem CID for Lithium L-lactate is 23687877.

What is the molecular formula of Lithium L-lactate?

The molecular formula of Lithium L-lactate is C3H5LiO3.

What are the synonyms for Lithium L-lactate?

The synonyms for Lithium L-lactate are Lithium (S)-2-hydroxypropanoate and (R)-BoroAbu-(+)-Pinanediol.

What is the molecular weight of Lithium L-lactate?

The molecular weight of Lithium L-lactate is 96.0 g/mol.

What is the IUPAC name of Lithium L-lactate?

The IUPAC name of Lithium L-lactate is lithium;(2S)-2-hydroxypropanoate.

What is the InChI of Lithium L-lactate?

The InChI of Lithium L-lactate is InChI=1S/C3H6O3.Li/c1-2(4)3(5)6;/h2,4H,1H3,(H,5,6);/q;+1/p-1/t2-;/m0./s1.

What is the InChIKey of Lithium L-lactate?

The InChIKey of Lithium L-lactate is GKQWYZBANWAFMQ-DKWTVANSSA-M.

What is the canonical SMILES of Lithium L-lactate?

The canonical SMILES of Lithium L-lactate is [Li+].CC(C(=O)[O-])O.

What is the isomeric SMILES of Lithium L-lactate?

The isomeric SMILES of Lithium L-lactate is [Li+].C[C@@H](C(=O)[O-])O.

What is the CAS number of Lithium L-lactate?

The CAS number of Lithium L-lactate is 27848-80-2.