Prostaglandin f2a

• CAS: 551-11-1
• Catalog Number: ACM551111
• Category: Other Products
• Molecular Weight: 354.48
• Molecular Formula: C₂₀H₃₄O₅
• Synonyms: PROSTAGLANDIN F2ALPHA;PGF2ALPHA;9ALPHA,11ALPHA,15S-TRIHYDROXY-PROSTA-5Z,13E-DIEN-1-OIC ACID;DINOPROST;(5z,9alpha,11alpha,13e,15s)-9,11,15-trihydroxyprosta-3,13-dien-1-oicacid;2beta(s*,e),3alpha,5alpha))-alpha(z;5-dihydroxy-2-(3-hydroxy-1-octenyl)cyclopentyl)-7-(l-5-heptenoicaci;7-(3,5-dihydroxy-2-(3-hydroxy-1-octenyl)cyclopentyl)-5-heptenoicaci

Custom Q&A

What is the molecular formula of Prostaglandin F2a?

The molecular formula of Prostaglandin F2a is C20H34O5.

What is the molecular weight of Prostaglandin F2a?

The molecular weight of Prostaglandin F2a is 354.5 g/mol.

What is the IUPAC name of Prostaglandin F2a?

The IUPAC name of Prostaglandin F2a is (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]hept-5-enoic acid.

What is the InChIKey of Prostaglandin F2a?

The InChIKey of Prostaglandin F2a is PXGPLTODNUVGFL-YNNPMVKQSA-N.

What is the canonical SMILES of Prostaglandin F2a?

The canonical SMILES of Prostaglandin F2a is CCCCCC(C=CC1C(CC(C1CC=CCCCC(=O)O)O)O)O.

What is the CAS number of Prostaglandin F2a?

The CAS number of Prostaglandin F2a is 551-11-1.

What is the XLogP3 value of Prostaglandin F2a?

The XLogP3 value of Prostaglandin F2a is 2.7.

How many hydrogen bond donor counts does Prostaglandin F2a have?

Prostaglandin F2a has 4 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does Prostaglandin F2a have?

Prostaglandin F2a has 5 hydrogen bond acceptor counts.

How many rotatable bond counts does Prostaglandin F2a have?

Prostaglandin F2a has 12 rotatable bond counts.