Propargyl-3-sulfopropyl ether sodium salt

• CAS: 30290-53-0
• Catalog Number: ACM30290530
• Category: Other Products
• Molecular Weight: 360.38
• Molecular Formula: C₁₂H₁₇NaO₇S₂
• Synonyms: popsliquid;SODIUM 3-(PROP-2-YNYLOXY)PROPANE-1-SULFONATE;POPS;PROPARGYL (3-SULFOPROPYL) ETHER, SODIUM SALT;3-(2-Propynyloxy)-1-propanesulfonic acid, sodium salt;Propargyl-3-sulfopropyl ether sodium;Propargyl (3-sulfopropyl) ether;Propargyl (3-sulfopropyl) ether sodiuM salt solution,~45% in water

Custom Q&A

What is the molecular formula of Propargyl-3-sulfopropyl ether sodium salt?

The molecular formula of Propargyl-3-sulfopropyl ether sodium salt is C6H9NaO4S.

What is the molecular weight of Propargyl-3-sulfopropyl ether sodium salt?

The molecular weight of Propargyl-3-sulfopropyl ether sodium salt is 200.19 g/mol.

What is the IUPAC name of Propargyl-3-sulfopropyl ether sodium salt?

The IUPAC name of Propargyl-3-sulfopropyl ether sodium salt is sodium;3-prop-2-ynoxypropane-1-sulfonate.

What is the InChI of Propargyl-3-sulfopropyl ether sodium salt?

The InChI of Propargyl-3-sulfopropyl ether sodium salt is InChI=1S/C6H10O4S.Na/c1-2-4-10-5-3-6-11(7,8)9;/h1H,3-6H2,(H,7,8,9);/q;+1/p-1.

What is the Canonical SMILES of Propargyl-3-sulfopropyl ether sodium salt?

The Canonical SMILES of Propargyl-3-sulfopropyl ether sodium salt is C#CCOCCCS(=O)(=O)[O-].[Na+].

What is the CAS number for Propargyl-3-sulfopropyl ether sodium salt?

The CAS number for Propargyl-3-sulfopropyl ether sodium salt is 30290-53-0.

How many hydrogen bond acceptors are there in Propargyl-3-sulfopropyl ether sodium salt?

There are 4 hydrogen bond acceptors in Propargyl-3-sulfopropyl ether sodium salt.

What is the topological polar surface area of Propargyl-3-sulfopropyl ether sodium salt?

The topological polar surface area of Propargyl-3-sulfopropyl ether sodium salt is 74.8 Ų.

How many heavy atoms are there in Propargyl-3-sulfopropyl ether sodium salt?

There are 12 heavy atoms in Propargyl-3-sulfopropyl ether sodium salt.

Is the compound canonicalized?

Yes, the compound is canonicalized.