What is the molecular formula of Vinylmethylbis(methylethylketoximino)silane?
The molecular formula is C11H22N2O2Si.
What is the molecular weight of Vinylmethylbis(methylethylketoximino)silane?
The molecular weight is 242.39 g/mol.
What is the IUPAC name of Vinylmethylbis(methylethylketoximino)silane?
The IUPAC name is (E)-N-[[(E)-butan-2-ylideneamino]oxy-ethenyl-methylsilyl]oxybutan-2-imine.
What is the InChI of Vinylmethylbis(methylethylketoximino)silane?
The InChI is InChI=1S/C11H22N2O2Si/c1-7-10(4)12-14-16(6,9-3)15-13-11(5)8-2/h9H,3,7-8H2,1-2,4-6H3/b12-10+,13-11+.
What is the InChIKey of Vinylmethylbis(methylethylketoximino)silane?
The InChIKey is YMTJPBFJJAVFRK-DCIPZJNNSA-N.
What is the canonical SMILES of Vinylmethylbis(methylethylketoximino)silane?
The canonical SMILES is CCC(=NO[Si](C)(C=C)ON=C(C)CC)C.
What is the CAS number of Vinylmethylbis(methylethylketoximino)silane?
The CAS number is 72721-10-9.
What is the EC number of Vinylmethylbis(methylethylketoximino)silane?
The EC number is 276-784-5.
How many hydrogen bond donor counts does Vinylmethylbis(methylethylketoximino)silane have?
It does not have any hydrogen bond donor count.
How many hydrogen bond acceptor counts does Vinylmethylbis(methylethylketoximino)silane have?
It has 4 hydrogen bond acceptor counts.
How many rotatable bond counts does Vinylmethylbis(methylethylketoximino)silane have?
Vinylmethylbis(methylethylketoximino)silane has 7 rotatable bond counts.
What is the exact mass of Vinylmethylbis(methylethylketoximino)silane?
The exact mass is 242.14505448 g/mol.
What is the topological polar surface area of Vinylmethylbis(methylethylketoximino)silane?
The topological polar surface area is 43.2Ų.
How many defined bond stereocenter counts does Vinylmethylbis(methylethylketoximino)silane have?
Vinylmethylbis(methylethylketoximino)silane has 2 defined bond stereocenter counts.