1,2,3,6-Tetrahydropyridine-4-yl-boronic acid pinacol ester hydrochloride

CAS

1121057-75-7

Catalog Number

ACM1121057757-1

Category

Boronic Esters

Molecular Weight

245.5554

Molecular Formula

C11H21BClNO2

MSDS COA Spec Sheet

If you have any other questions or need other size, please get a quote.

Specification

MDL Number

MFCD11506076

Size

1g,5g,25g

What is the PubChem CID for 1,2,3,6-Tetrahydropyridine-4-yl-boronic acid pinacol ester hydrochloride?

The PubChem CID for 1,2,3,6-Tetrahydropyridine-4-yl-boronic acid pinacol ester hydrochloride is 49761084.

What is the molecular formula of 1,2,3,6-Tetrahydropyridine-4-yl-boronic acid pinacol ester hydrochloride?

The molecular formula of 1,2,3,6-Tetrahydropyridine-4-yl-boronic acid pinacol ester hydrochloride is C11H21BClNO2.

What is the molecular weight of 1,2,3,6-Tetrahydropyridine-4-yl-boronic acid pinacol ester hydrochloride?

The molecular weight of 1,2,3,6-Tetrahydropyridine-4-yl-boronic acid pinacol ester hydrochloride is 245.55 g/mol.

What is the IUPAC Name of 1,2,3,6-Tetrahydropyridine-4-yl-boronic acid pinacol ester hydrochloride?

The IUPAC Name of 1,2,3,6-Tetrahydropyridine-4-yl-boronic acid pinacol ester hydrochloride is "4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,3,6-tetrahydropyridine;hydrochloride."

What is the InChI of 1,2,3,6-Tetrahydropyridine-4-yl-boronic acid pinacol ester hydrochloride?

The InChI of 1,2,3,6-Tetrahydropyridine-4-yl-boronic acid pinacol ester hydrochloride is "InChI=1S/C11H20BNO2.ClH/c1-10(2)11(3,4)15-12(14-10)9-5-7-13-8-6-9;/h5,13H,6-8H2,1-4H3;1H."

What is the InChIKey of 1,2,3,6-Tetrahydropyridine-4-yl-boronic acid pinacol ester hydrochloride?

The InChIKey of 1,2,3,6-Tetrahydropyridine-4-yl-boronic acid pinacol ester hydrochloride is "WNMYCAJTXUCHBQ-UHFFFAOYSA-N."

What is the Canonical SMILES of 1,2,3,6-Tetrahydropyridine-4-yl-boronic acid pinacol ester hydrochloride?

The Canonical SMILES of 1,2,3,6-Tetrahydropyridine-4-yl-boronic acid pinacol ester hydrochloride is "B1(OC(C(O1)(C)C)(C)C)C2=CCNCC2.Cl."

What is the CAS number of 1,2,3,6-Tetrahydropyridine-4-yl-boronic acid pinacol ester hydrochloride?

The CAS number of 1,2,3,6-Tetrahydropyridine-4-yl-boronic acid pinacol ester hydrochloride is 1121057-75-7.

What is the molecular weight of 1,2,3,6-Tetrahydro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine hydrochloride?

The molecular weight of 1,2,3,6-Tetrahydro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine hydrochloride is not provided in the reference.

What is the EC number of 1,2,3,6-Tetrahydropyridine-4-yl-boronic acid pinacol ester hydrochloride?

The EC number of 1,2,3,6-Tetrahydropyridine-4-yl-boronic acid pinacol ester hydrochloride is 878-854-6.