(R)-Boroleu-(+)-Pinanediol-Hcl

CAS

779357-85-6

Catalog Number

ACM779357856

Category

Boro-Amino Acids

Molecular Weight

301.66 g/mol

Molecular Formula

C15H28BNO2·HCl

MSDS COA Spec Sheet

If you have any other questions or need other size, please get a quote.

Specification

Synonyms

(1R)-3-Methyl-1-[(1S,2S,6R,8S)-2,9,9-Trimethyl-3,5-Dioxa-4-Boratricyclo[6.1.1.02,6]Dec-4-Yl]Butan-1-AminehydrCHloride(1:1)(R)-1-Ami-3-MethylbutylboronicacidpinanediolesterhydrCHloride(R)-Boroleu-(+)-PinanediolhydrCHloride

What is the molecular formula of (R)-BoroLeu-(+)-Pinanediol-HCl?

The molecular formula is C15H29BClNO2.

What is the molecular weight of (R)-BoroLeu-(+)-Pinanediol-HCl?

The molecular weight is 301.7 g/mol.

What is the IUPAC name of (R)-BoroLeu-(+)-Pinanediol-HCl?

The IUPAC name is (1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butan-1-amine;hydrochloride.

What is the InChI of (R)-BoroLeu-(+)-Pinanediol-HCl?

The InChI is InChI=1S/C15H28BNO2.ClH/c1-9(2)6-13(17)16-18-12-8-10-7-11(14(10,3)4)15(12,5)19-16;/h9-13H,6-8,17H2,1-5H3;1H/t10-,11-,12+,13-,15-;/m0./s1.

What is the Canonical SMILES of (R)-BoroLeu-(+)-Pinanediol-HCl?

The Canonical SMILES is B1(OC2CC3CC(C3(C)C)C2(O1)C)C(CC(C)C)N.Cl.

How many hydrogen bond donor counts does (R)-BoroLeu-(+)-Pinanediol-HCl have?

It has 2 hydrogen bond donor counts.

What is the exact mass of (R)-BoroLeu-(+)-Pinanediol-HCl?

The exact mass is 301.1979870 g/mol.

What is the topological polar surface area of (R)-BoroLeu-(+)-Pinanediol-HCl?

The topological polar surface area is 44.5 Å².

How many defined atom stereocenter counts does (R)-BoroLeu-(+)-Pinanediol-HCl have?

It has 5 defined atom stereocenter counts.

Is (R)-BoroLeu-(+)-Pinanediol-HCl a canonicalized compound?

Yes, it is a canonicalized compound.