99059-91-3 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of 1,8-naphthyridine-4-carboxylic acid is C9H6N2O2.
The molecular weight of 1,8-naphthyridine-4-carboxylic acid is 174.16 g/mol.
The IUPAC name of 1,8-naphthyridine-4-carboxylic acid is 1,8-naphthyridine-4-carboxylic acid.
The InChI of 1,8-naphthyridine-4-carboxylic acid is InChI=1S/C9H6N2O2/c12-9(13)7-3-5-11-8-6(7)2-1-4-10-8/h1-5H,(H,12,13).
The InChIKey of 1,8-naphthyridine-4-carboxylic acid is OHLKQPVOQXXCDW-UHFFFAOYSA-N.
The canonical SMILES of 1,8-naphthyridine-4-carboxylic acid is C1=CC2=C(C=CN=C2N=C1)C(=O)O.
The CAS number of 1,8-naphthyridine-4-carboxylic acid is 99066-71-4.
The XLogP3-AA value of 1,8-naphthyridine-4-carboxylic acid is 1.
There is one hydrogen bond donor count in 1,8-naphthyridine-4-carboxylic acid.
There are four hydrogen bond acceptor counts in 1,8-naphthyridine-4-carboxylic acid.