What is the molecular formula of (Methacryloxymethyl)bis(trimethylsiloxy)methylsilane?
The molecular formula is C12H28O4Si3.
What is the PubChem CID of (Methacryloxymethyl)bis(trimethylsiloxy)methylsilane?
The PubChem CID is 16051442.
What is the IUPAC name of (Methacryloxymethyl)bis(trimethylsiloxy)methylsilane?
The IUPAC name is [methyl-bis(trimethylsilyloxy)silyl]methyl 2-methylprop-2-enoate.
What is the InChI of (Methacryloxymethyl)bis(trimethylsiloxy)methylsilane?
The InChI is InChI=1S/C12H28O4Si3/c1-11(2)12(13)14-10-19(9,15-17(3,4)5)16-18(6,7)8/h1,10H2,2-9H3.
What is the InChIKey of (Methacryloxymethyl)bis(trimethylsiloxy)methylsilane?
The InChIKey is YPMNWQTVWVHXIQ-UHFFFAOYSA-N.
What is the canonical SMILES of (Methacryloxymethyl)bis(trimethylsiloxy)methylsilane?
The canonical SMILES is CC(=C)C(=O)OC[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C.
What is the molecular weight of (Methacryloxymethyl)bis(trimethylsiloxy)methylsilane?
The molecular weight is 320.60 g/mol.
How many hydrogen bond donor counts are there in (Methacryloxymethyl)bis(trimethylsiloxy)methylsilane?
There are 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts are there in (Methacryloxymethyl)bis(trimethylsiloxy)methylsilane?
There are 4 hydrogen bond acceptor counts.
How many rotatable bond counts are there in (Methacryloxymethyl)bis(trimethylsiloxy)methylsilane?
There are 8 rotatable bond counts.