CAS
5337-17-7 Purity
---
5337-17-7 Purity
---
Inquiry Basket
L-Phenylacetyl Carbinol
CAS
53439-91-1
Catalog Number
ACM53439911
Category
Other Products
Molecular Weight
150.17
Molecular Formula
C9H10O2
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Synonyms
(1S)-1-Hydroxy-1-Phenyl-2-Propanone
Canonical SMILES
CC(=O)[C@H](C1=CC=CC=C1)O
What is the molecular formula of L-Phenylacetyl carbinol?
The molecular formula of L-Phenylacetyl carbinol is C9H10O2.
What is the molecular weight of L-Phenylacetyl carbinol?
The molecular weight of L-Phenylacetyl carbinol is 150.17 g/mol.
What is the IUPAC name of L-Phenylacetyl carbinol?
The IUPAC name of L-Phenylacetyl carbinol is (1S)-1-hydroxy-1-phenylpropan-2-one.
What is the InChIKey of L-Phenylacetyl carbinol?
The InChIKey of L-Phenylacetyl carbinol is ZBFFNPODXBJBPW-SECBINFHSA-N.
What is the CAS number of L-Phenylacetyl carbinol?
The CAS number of L-Phenylacetyl carbinol is 53439-91-1.
What is the XLogP3-AA value of L-Phenylacetyl carbinol?
The XLogP3-AA value of L-Phenylacetyl carbinol is 1.
How many hydrogen bond donor counts does L-Phenylacetyl carbinol have?
L-Phenylacetyl carbinol has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does L-Phenylacetyl carbinol have?
L-Phenylacetyl carbinol has 2 hydrogen bond acceptor counts.
How many rotatable bond counts does L-Phenylacetyl carbinol have?
L-Phenylacetyl carbinol has 2 rotatable bond counts.
What is the topological polar surface area of L-Phenylacetyl carbinol?
The topological polar surface area of L-Phenylacetyl carbinol is 37.3 ?^2.
Recommended Products
