6-Hydroxynaphthalene-2-sulfonic acid

CAS

93-01-6

Catalog Number

ACM93016

Category

Main Products

Molecular Weight

224.24

Molecular Formula

C10H8O4S

MSDS COA Spec Sheet

If you have any other questions or need other size, please get a quote.

Specification

Synonyms

2-Naphthol-6-sulfonic acid

Application

6-Hydroxynaphthalene-2-sulfonic acid is a crucial coupling component in the production of various azo dyes, such as C.I. Acid Orange 12, C.I. Food Yellow 3, and C.I. Food Orange 2. Additionally, it serves as an important intermediate for the creation of more complex dye components and synthetic tanning agents. Furthermore, the 1-nitroso derivative of this compound is utilized to form an iron complex (C.I. Acid Green 1), which was traditionally utilized as a dye for wool.

What is the molecular formula of 6-Hydroxynaphthalene-2-sulphonic acid?

The molecular formula of 6-Hydroxynaphthalene-2-sulphonic acid is C10H8O4S.

What is the molecular weight of 6-Hydroxynaphthalene-2-sulphonic acid?

The molecular weight of 6-Hydroxynaphthalene-2-sulphonic acid is 224.23 g/mol.

What are some synonyms for 6-Hydroxynaphthalene-2-sulphonic acid?

Some synonyms for 6-Hydroxynaphthalene-2-sulphonic acid include 6-hydroxynaphthalene-2-sulfonic acid, 2-Naphthol-6-sulfonic acid, and Schaeffer's acid.

When was 6-Hydroxynaphthalene-2-sulphonic acid created and last modified?

6-Hydroxynaphthalene-2-sulphonic acid was created on 2005-03-26 and last modified on 2023-12-30.

What is the IUPAC name of 6-Hydroxynaphthalene-2-sulphonic acid?

The IUPAC name of 6-Hydroxynaphthalene-2-sulphonic acid is 6-hydroxynaphthalene-2-sulfonic acid.

What is the InChIKey of 6-Hydroxynaphthalene-2-sulphonic acid?

The InChIKey of 6-Hydroxynaphthalene-2-sulphonic acid is VVPHSMHEYVOVLH-UHFFFAOYSA-N.

What is the Canonical SMILES of 6-Hydroxynaphthalene-2-sulphonic acid?

The Canonical SMILES of 6-Hydroxynaphthalene-2-sulphonic acid is C1=CC2=C(C=CC(=C2)S(=O)(=O)O)C=C1O.

What is the CAS number of 6-Hydroxynaphthalene-2-sulphonic acid?

The CAS number of 6-Hydroxynaphthalene-2-sulphonic acid is 93-01-6.

What is the XLogP3 value of 6-Hydroxynaphthalene-2-sulphonic acid?

The XLogP3 value of 6-Hydroxynaphthalene-2-sulphonic acid is 0.3.

How many hydrogen bond donor count does 6-Hydroxynaphthalene-2-sulphonic acid have?

6-Hydroxynaphthalene-2-sulphonic acid has 2 hydrogen bond donor counts.