Hydroxylamine,o-[(1,1-dimethylethyl)diphenylsilyl]-

• CAS: 103587-51-5
• Catalog Number: ACM103587515
• Category: Siloxanes
• Molecular Weight: 271.43
• Molecular Formula: C₁₆H₂₁NOSi
• Appearance: Transparent liquid

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C16H21NOSi.

What is the molecular weight of the compound?

The molecular weight of the compound is 271.43 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is O-[tert-butyl(diphenyl)silyl]hydroxylamine.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C16H21NOSi/c1-16(2,3)19(18-17,14-10-6-4-7-11-14)15-12-8-5-9-13-15/h4-13H,17H2,1-3H3.

What is the InChIKey of the compound?

The InChIKey of the compound is PWTWOGMXABHJOA-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is CC(C)(C)[Si](C1=CC=CC=C1)(C2=CC=CC=C2)ON.

What is the CAS number of the compound?

The CAS number of the compound is 103587-51-5.

What is the DSSTox Substance ID of the compound?

The DSSTox Substance ID of the compound is DTXSID10471449.

How many hydrogen bond donor counts does the compound have?

The compound has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does the compound have?

The compound has 2 hydrogen bond acceptor counts.

Synthetic Use

Downstream Synthesis Route 1

• 94571-13-8
• 103587-51-5

• 118684-94-9

Reference: [1]Stewart, Andrew O.; Martin, Jonathan G.
[Journal of Organic Chemistry, 1989, vol. 54, # 5, p. 1221 - 1223]

* For details of the synthesis route, please refer to the original source to ensure accuracy.