Euscaphin B

• CAS: 956869-95-7
• Catalog Number: ACM956869957
• Category: Other Products
• Molecular Weight: 258.4
• Molecular Formula: C14H26O4
• IUPAC Name: (1S,3R,6S)-6-[(E,3R)-3-hydroxybut-1-enyl]-6-methoxy-1,5,5-trimethylcyclohexane-1,3-diol
• Canonical SMILES: CC(C=CC1(C(CC(CC1(C)O)O)(C)C)OC)O
• InChI: InChI=1S/C14H26O4/c1-10(15)6-7-14(18-5)12(2,3)8-11(16)9-13(14,4)17/h6-7,10-11,15-17H,8-9H2,1-5H3/b7-6+/t10-,11-,13+,14+/m1/s1
• InChI Key: UIQSLOCCENWDIG-UYJPZPQLSA-N
• Density: 5mg 10mg 20 mg
• Appearance: Powder
• Physical Description: Powder

Custom Q&A

What is the molecular formula of Euscaphin B?

The molecular formula of Euscaphin B is C14H26O4.

What is the PubChem CID of Euscaphin B?

The PubChem CID of Euscaphin B is 91885086.

What is the IUPAC name of Euscaphin B?

The IUPAC name of Euscaphin B is (1S,3R,6S)-6-[(E,3R)-3-hydroxybut-1-enyl]-6-methoxy-1,5,5-trimethylcyclohexane-1,3-diol.

What is the InChI of Euscaphin B?

The InChI of Euscaphin B is InChI=1S/C14H26O4/c1-10(15)6-7-14(18-5)12(2,3)8-11(16)9-13(14,4)17/h6-7,10-11,15-17H,8-9H2,1-5H3/b7-6+/t10-,11-,13+,14+/m1/s1.

What is the InChIKey of Euscaphin B?

The InChIKey of Euscaphin B is UIQSLOCCENWDIG-UYJPZPQLSA-N.

What is the canonical SMILES of Euscaphin B?

The canonical SMILES of Euscaphin B is CC(C=CC1(C(CC(CC1(C)O)O)(C)C)OC)O.

What is the isomeric SMILES of Euscaphin B?

The isomeric SMILES of Euscaphin B is C[C@H](/C=C/[C@]1([C@@](C[C@@H](CC1(C)C)O)(C)O)OC)O.

What is the molecular weight of Euscaphin B?

The molecular weight of Euscaphin B is 258.35 g/mol.

How many hydrogen bond donor counts does Euscaphin B have?

Euscaphin B has 3 hydrogen bond donor counts.

What is the topological polar surface area of Euscaphin B?

The topological polar surface area of Euscaphin B is 69.9?^2.