Di-N-octyldimethoxysilane

• CAS: 947155-81-9
• Catalog Number: ACM947155819
• Category: Siloxanes
• Molecular Weight: 316.59
• Molecular Formula: C18H40O2Si
• Synonyms: Silane, dimethoxydioctyl-
• Appearance: liquid

Custom Q&A

What is the molecular formula of di-n-octyldimethoxysilane?

The molecular formula of di-n-octyldimethoxysilane is C18H40O2Si.

What is the molecular weight of di-n-octyldimethoxysilane?

The molecular weight of di-n-octyldimethoxysilane is 316.6 g/mol.

What is the IUPAC name of di-n-octyldimethoxysilane?

The IUPAC name of di-n-octyldimethoxysilane is dimethoxy(dioctyl)silane.

What is the InChI of di-n-octyldimethoxysilane?

The InChI of di-n-octyldimethoxysilane is InChI=1S/C18H40O2Si/c1-5-7-9-11-13-15-17-21(19-3,20-4)18-16-14-12-10-8-6-2/h5-18H2,1-4H3.

What is the InChIKey of di-n-octyldimethoxysilane?

The InChIKey of di-n-octyldimethoxysilane is TYXIAHKLJMLPIP-UHFFFAOYSA-N.

What is the canonical SMILES of di-n-octyldimethoxysilane?

The canonical SMILES of di-n-octyldimethoxysilane is CCCCCCCC[Si](CCCCCCCC)(OC)OC.

What is the CAS number of di-n-octyldimethoxysilane?

The CAS number of di-n-octyldimethoxysilane is 947155-81-9.

What is the hydrogen bond donor count of di-n-octyldimethoxysilane?

The hydrogen bond donor count of di-n-octyldimethoxysilane is 0.

What is the hydrogen bond acceptor count of di-n-octyldimethoxysilane?

The hydrogen bond acceptor count of di-n-octyldimethoxysilane is 2.

Is di-n-octyldimethoxysilane covalently-bonded?

Yes, di-n-octyldimethoxysilane is covalently-bonded.