954239-64-6 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C9H6BrNO3.
The molecular weight of the compound is 256.05 g/mol.
The IUPAC name of the compound is methyl 7-bromo-1,3-benzoxazole-2-carboxylate.
The InChI of the compound is InChI=1S/C9H6BrNO3/c1-13-9(12)8-11-6-4-2-3-5(10)7(6)14-8/h2-4H,1H3.
The InChIKey of the compound is SBTSZQYXJFNLCG-UHFFFAOYSA-N.
The canonical SMILES of the compound is COC(=O)C1=NC2=C(O1)C(=CC=C2)Br.
The CAS number of the compound is 954239-78-2.
The XLogP3-AA value of the compound is 2.6.
The compound has 0 hydrogen bond donor counts.
The compound has 4 hydrogen bond acceptor counts.