Bis(Methyldimethoxysilyl)Methane

• CAS: 18297-79-5
• Catalog Number: ACM18297795
• Category: Siloxanes
• Molecular Weight: 224.4 g/mol
• Molecular Formula: C7H20O4Si2
• Synonyms: 2,2,4,4-Tetramethoxy-1,3-Disilapentane2,6-Dioxa-3,5-Disilaheptane,3,5-Dimethoxy-3,5-Dimethyl-
• Appearance: Liquid
• Packaging: 10 g; 100 g

Custom Q&A

What is the molecular formula of bis(methyldimethoxysilyl)methane?

The molecular formula is C7H20O4Si2.

What is the molecular weight of bis(methyldimethoxysilyl)methane?

The molecular weight is 224.40 g/mol.

What is the IUPAC name of bis(methyldimethoxysilyl)methane?

The IUPAC name is [dimethoxy(methyl)silyl]methyl-dimethoxy-methylsilane.

What is the InChI of bis(methyldimethoxysilyl)methane?

The InChI is InChI=1S/C7H20O4Si2/c1-8-12(5,9-2)7-13(6,10-3)11-4/h7H2,1-6H3.

What is the InChIKey of bis(methyldimethoxysilyl)methane?

The InChIKey is IBSRZWOEDXOVEO-UHFFFAOYSA-N.

What is the canonical SMILES of bis(methyldimethoxysilyl)methane?

The canonical SMILES is CO[Si](C)(C[Si](C)(OC)OC).

What is the CAS number of bis(methyldimethoxysilyl)methane?

The CAS number is 18297-79-5.

What is the European Community (EC) number of bis(methyldimethoxysilyl)methane?

The EC number is 628-872-3.

How many hydrogen bond donor atoms are in bis(methyldimethoxysilyl)methane?

There are 0 hydrogen bond donor atoms.

How many hydrogen bond acceptor atoms are in bis(methyldimethoxysilyl)methane?

There are 4 hydrogen bond acceptor atoms.